Difference between revisions of "PLASTOQUINONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4441 == * common-name: ** cis-zeatin * molecular-weight: ** 219.246 * inchi-key: ** uzkqtcbamswpjd-uqcoibpssa-n * smiles: ** cc(co)=c...")
(Created page with "Category:metabolite == Metabolite PLASTOQUINONE == * common-name: ** a plastoquinone == Reaction(s) known to consume the compound == * RXN-15451 == Reaction(s) known t...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4441 ==
+
== Metabolite PLASTOQUINONE ==
 
* common-name:
 
* common-name:
** cis-zeatin
+
** a plastoquinone
* molecular-weight:
 
** 219.246
 
* inchi-key:
 
** uzkqtcbamswpjd-uqcoibpssa-n
 
* smiles:
 
** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4733]]
+
* [[RXN-15451]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cis-zeatin}}
+
{{#set: common-name=a plastoquinone}}
{{#set: molecular-weight=219.246}}
 
{{#set: inchi-key=inchikey=uzkqtcbamswpjd-uqcoibpssa-n}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite PLASTOQUINONE

  • common-name:
    • a plastoquinone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality