Difference between revisions of "S-CD-S-SP-Complex"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THZ-P == * common-name: ** 4-methyl-5-(2-phosphooxyethyl)thiazole * molecular-weight: ** 221.167 * inchi-key: ** ocymerzcmyjqqo-uhfffaoys...")
 
(Created page with "Category:metabolite == Metabolite S-CD-S-SP-Complex == * common-name: ** an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex == Reac...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THZ-P ==
+
== Metabolite S-CD-S-SP-Complex ==
 
* common-name:
 
* common-name:
** 4-methyl-5-(2-phosphooxyethyl)thiazole
+
** an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex
* molecular-weight:
 
** 221.167
 
* inchi-key:
 
** ocymerzcmyjqqo-uhfffaoysa-l
 
* smiles:
 
** cc1(n=csc(ccop([o-])(=o)[o-])=1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[THI-P-SYN-RXN]]
+
* [[RXN-14386]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14385]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-methyl-5-(2-phosphooxyethyl)thiazole}}
+
{{#set: common-name=an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex}}
{{#set: molecular-weight=221.167}}
 
{{#set: inchi-key=inchikey=ocymerzcmyjqqo-uhfffaoysa-l}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite S-CD-S-SP-Complex

  • common-name:
    • an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.