Difference between revisions of "MYO-INOSITOL"

Latest revision as of 19:36, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite THZ-P ==
+== Metabolite MYO-INOSITOL ==
 * common-name:
-** 4-methyl-5-(2-phosphooxyethyl)thiazole
+** myo-inositol
 * molecular-weight:
-** 221.167
+** 180.157
 * inchi-key:
-** ocymerzcmyjqqo-uhfffaoysa-l
+** cdaismweouebre-gpivlxjgsa-n
 * smiles:
-** cc1(n=csc(ccop([o-])(=o)[o-])=1)
+** c1(c(c(c(c(c1o)o)o)o)o)o
 == Reaction(s) known to consume the compound ==
-* [[THI-P-SYN-RXN]]
+* [[2.4.1.67-RXN]]
+* [[2.7.8.11-RXN]]
+* [[MYO-INOSITOL-OXYGENASE-RXN]]
 == Reaction(s) known to produce the compound ==
+* [[2.4.1.67-RXN]]
+* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
+* [[RXN-10949]]
+* [[RXN-10952]]
+* [[RXN-10953]]
+* [[RXN-10954]]
+* [[RXN-7253]]
+* [[RXN0-5408]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=4-methyl-5-(2-phosphooxyethyl)thiazole}}
+{{#set: common-name=myo-inositol}}
-{{#set: molecular-weight=221.167}}
+{{#set: molecular-weight=180.157}}
-{{#set: inchi-key=inchikey=ocymerzcmyjqqo-uhfffaoysa-l}}
+{{#set: inchi-key=inchikey=cdaismweouebre-gpivlxjgsa-n}}