Difference between revisions of "MYO-INOSITOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1028 == * common-name: ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate * molecular-weight: ** 447.424 * inchi-key: ** oinneunvo...")
(Created page with "Category:metabolite == Metabolite MYO-INOSITOL == * common-name: ** myo-inositol * molecular-weight: ** 180.157 * inchi-key: ** cdaismweouebre-gpivlxjgsa-n * smiles: ** c1...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1028 ==
+
== Metabolite MYO-INOSITOL ==
 
* common-name:
 
* common-name:
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
+
** myo-inositol
 
* molecular-weight:
 
* molecular-weight:
** 447.424
+
** 180.157
 
* inchi-key:
 
* inchi-key:
** oinneunvozhbox-kwbdajkesa-k
+
** cdaismweouebre-gpivlxjgsa-n
 
* smiles:
 
* smiles:
** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c
+
** c1(c(c(c(c(c1o)o)o)o)o)o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.4.1.67-RXN]]
 +
* [[2.7.8.11-RXN]]
 +
* [[MYO-INOSITOL-OXYGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5180]]
+
* [[2.4.1.67-RXN]]
 +
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
 +
* [[RXN-10949]]
 +
* [[RXN-10952]]
 +
* [[RXN-10953]]
 +
* [[RXN-10954]]
 +
* [[RXN-7253]]
 +
* [[RXN0-5408]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
+
{{#set: common-name=myo-inositol}}
{{#set: molecular-weight=447.424}}
+
{{#set: molecular-weight=180.157}}
{{#set: inchi-key=inchikey=oinneunvozhbox-kwbdajkesa-k}}
+
{{#set: inchi-key=inchikey=cdaismweouebre-gpivlxjgsa-n}}

Latest revision as of 19:36, 17 March 2021

Metabolite MYO-INOSITOL

  • common-name:
    • myo-inositol
  • molecular-weight:
    • 180.157
  • inchi-key:
    • cdaismweouebre-gpivlxjgsa-n
  • smiles:
    • c1(c(c(c(c(c1o)o)o)o)o)o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality