Difference between revisions of "Charged-HIS-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-ARGININO-SUCCINATE == * common-name: ** l-arginino-succinate * molecular-weight: ** 289.267 * inchi-key: ** kdzoasgqnopscu-zbhicjrosa-m...")
(Created page with "Category:metabolite == Metabolite Charged-HIS-tRNAs == * common-name: ** an l-histidyl-[trnahis] == Reaction(s) known to consume the compound == == Reaction(s) known to pr...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-ARGININO-SUCCINATE ==
+
== Metabolite Charged-HIS-tRNAs ==
 
* common-name:
 
* common-name:
** l-arginino-succinate
+
** an l-histidyl-[trnahis]
* molecular-weight:
 
** 289.267
 
* inchi-key:
 
** kdzoasgqnopscu-zbhicjrosa-m
 
* smiles:
 
** c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARGSUCCINLYA-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ARGSUCCINLYA-RXN]]
+
* [[HISTIDINE--TRNA-LIGASE-RXN]]
* [[ARGSUCCINSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-arginino-succinate}}
+
{{#set: common-name=an l-histidyl-[trnahis]}}
{{#set: molecular-weight=289.267}}
 
{{#set: inchi-key=inchikey=kdzoasgqnopscu-zbhicjrosa-m}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite Charged-HIS-tRNAs

  • common-name:
    • an l-histidyl-[trnahis]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-histidyl-[trnahis" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.