Difference between revisions of "GALACTOSYLCERAMIDE-SULFATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE == * common-name: ** sn-glycero-3-phosphocholine * molecular-weight: ** 257.223 * inchi-key: ** suhoquvvvln...")
(Created page with "Category:metabolite == Metabolite GALACTOSYLCERAMIDE-SULFATE == * common-name: ** a sulfatide == Reaction(s) known to consume the compound == == Reaction(s) known to produ...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE ==
+
== Metabolite GALACTOSYLCERAMIDE-SULFATE ==
 
* common-name:
 
* common-name:
** sn-glycero-3-phosphocholine
+
** a sulfatide
* molecular-weight:
 
** 257.223
 
* inchi-key:
 
** suhoquvvvlnyqr-mrvpvssysa-n
 
* smiles:
 
** c([n+](c)(c)c)cop([o-])(=o)occ(o)co
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LYSOPHOSPHOLIPASE-RXN]]
+
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sn-glycero-3-phosphocholine}}
+
{{#set: common-name=a sulfatide}}
{{#set: molecular-weight=257.223}}
 
{{#set: inchi-key=inchikey=suhoquvvvlnyqr-mrvpvssysa-n}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite GALACTOSYLCERAMIDE-SULFATE

  • common-name:
    • a sulfatide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality