Difference between revisions of "3-HYDROXYADIPYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1063 == * common-name: ** 5-(methylsulfanyl)-ribulose 1-phosphate * molecular-weight: ** 258.182 * inchi-key: ** cnsjryumvmwnmc-ritpc...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXYADIPYL-COA == * common-name: ** (3s)-hydroxyadipyl-coa * molecular-weight: ** 906.621 * inchi-key: ** oteacgaedcimbs-notshufbsa-...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-1063 ==
+
== Metabolite 3-HYDROXYADIPYL-COA ==
 
* common-name:
 
* common-name:
** 5-(methylsulfanyl)-ribulose 1-phosphate
+
** (3s)-hydroxyadipyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 258.182
+
** 906.621
 
* inchi-key:
 
* inchi-key:
** cnsjryumvmwnmc-ritpcoansa-l
+
** oteacgaedcimbs-notshufbsa-i
 
* smiles:
 
* smiles:
** cscc(o)c(o)c(=o)cop([o-])(=o)[o-]
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R145-RXN]]
+
* [[RXN-2425]]
 +
* [[RXN0-2044]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[5.3.1.23-RXN]]
+
* [[RXN-2425]]
 +
* [[RXN0-2044]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-(methylsulfanyl)-ribulose 1-phosphate}}
+
{{#set: common-name=(3s)-hydroxyadipyl-coa}}
{{#set: molecular-weight=258.182}}
+
{{#set: molecular-weight=906.621}}
{{#set: inchi-key=inchikey=cnsjryumvmwnmc-ritpcoansa-l}}
+
{{#set: inchi-key=inchikey=oteacgaedcimbs-notshufbsa-i}}

Latest revision as of 19:36, 17 March 2021

Metabolite 3-HYDROXYADIPYL-COA

  • common-name:
    • (3s)-hydroxyadipyl-coa
  • molecular-weight:
    • 906.621
  • inchi-key:
    • oteacgaedcimbs-notshufbsa-i
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality