Difference between revisions of "3-HYDROXYADIPYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Arachidoyl-ACPs == * common-name: ** an arachidoyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-445 == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite 3-HYDROXYADIPYL-COA == * common-name: ** (3s)-hydroxyadipyl-coa * molecular-weight: ** 906.621 * inchi-key: ** oteacgaedcimbs-notshufbsa-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-HYDROXYADIPYL-COA == |
* common-name: | * common-name: | ||
| − | ** | + | ** (3s)-hydroxyadipyl-coa |
| + | * molecular-weight: | ||
| + | ** 906.621 | ||
| + | * inchi-key: | ||
| + | ** oteacgaedcimbs-notshufbsa-i | ||
| + | * smiles: | ||
| + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-2425]] |
| + | * [[RXN0-2044]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-2425]] |
| + | * [[RXN0-2044]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(3s)-hydroxyadipyl-coa}} |
| + | {{#set: molecular-weight=906.621}} | ||
| + | {{#set: inchi-key=inchikey=oteacgaedcimbs-notshufbsa-i}} | ||
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite 3-HYDROXYADIPYL-COA
- common-name:
- (3s)-hydroxyadipyl-coa
- molecular-weight:
- 906.621
- inchi-key:
- oteacgaedcimbs-notshufbsa-i
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
