Difference between revisions of "C3"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXYADIPYL-COA == * common-name: ** (3s)-hydroxyadipyl-coa * molecular-weight: ** 906.621 * inchi-key: ** oteacgaedcimbs-notshufbsa-...") |
(Created page with "Category:metabolite == Metabolite C3 == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanine * molecular-weight: ** 114...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite C3 == |
* common-name: | * common-name: | ||
− | ** | + | ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanine |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1146.922 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pfmvormcvgoqkr-xncokrrhsa-k |
* smiles: | * smiles: | ||
− | ** cc(c)(c(o)c(=o) | + | ** cc(c(=o)nc(c([o-])=o)c)nc(=o)c(cccc[n+])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op(op(occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)([o-])=o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-8975]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-8975]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanine}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1146.922}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pfmvormcvgoqkr-xncokrrhsa-k}} |
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite C3
- common-name:
- udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanine
- molecular-weight:
- 1146.922
- inchi-key:
- pfmvormcvgoqkr-xncokrrhsa-k
- smiles:
- cc(c(=o)nc(c([o-])=o)c)nc(=o)c(cccc[n+])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op(op(occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)([o-])=o)