Difference between revisions of "M7G5-pppR-mRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-heptaprenyl diphosphate * molecular-weight: ** 651.779 * inchi-key: ** l...")
(Created page with "Category:metabolite == Metabolite m7G5-pppR-mRNAs == * common-name: ** a 5'-(n7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mrna] == Reaction(s) known to consu...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE ==
+
== Metabolite m7G5-pppR-mRNAs ==
 
* common-name:
 
* common-name:
** all-trans-heptaprenyl diphosphate
+
** a 5'-(n7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mrna]
* molecular-weight:
 
** 651.779
 
* inchi-key:
 
** lsjlexwxrktzaj-yuiipxgzsa-k
 
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9222]]
+
* [[2.1.1.57-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-heptaprenyl diphosphate}}
+
{{#set: common-name=a 5'-(n7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mrna]}}
{{#set: molecular-weight=651.779}}
 
{{#set: inchi-key=inchikey=lsjlexwxrktzaj-yuiipxgzsa-k}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite m7G5-pppR-mRNAs

  • common-name:
    • a 5'-(n7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mrna]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 5'-(n7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mrna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.