Difference between revisions of "Beta-D-Glucans"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE == * common-name: ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate * molecular-weight: **...")
 
(Created page with "Category:metabolite == Metabolite Beta-D-Glucans == * common-name: ** a β-d glucan == Reaction(s) known to consume the compound == == Reaction(s) known to produce the...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE ==
+
== Metabolite Beta-D-Glucans ==
 
* common-name:
 
* common-name:
−
** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate
+
** a β-d glucan
−
* molecular-weight:
 
−
** 336.174
 
−
* inchi-key:
 
−
** xfvulmdjzxymsg-ziyngmlesa-k
 
−
* smiles:
 
−
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c=nc(c([o-])=o)=c(n)1))o2)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[AIRCARBOXY-RXN]]
 
−
* [[SAICARSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[AIRCARBOXY-RXN]]
+
* [[3.2.1.6-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate}}
+
{{#set: common-name=a β-d glucan}}
−
{{#set: molecular-weight=336.174}}
 
−
{{#set: inchi-key=inchikey=xfvulmdjzxymsg-ziyngmlesa-k}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite Beta-D-Glucans

  • common-name:
    • a β-d glucan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=Beta-D-Glucans&oldid=49999"