Difference between revisions of "E-"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-N-ACETYLMURAMATE == * common-name: ** udp-n-acetyl-α-d-muramate * molecular-weight: ** 676.397 * inchi-key: ** nqbrvzndbbmblj-m...")
(Created page with "Category:metabolite == Metabolite E- == == Reaction(s) known to consume the compound == * RXN-12647 * RXN-14451 * RXN-15451 * RXN-15468 * RXN-15815 * [...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-N-ACETYLMURAMATE ==
+
== Metabolite E- ==
* common-name:
 
** udp-n-acetyl-α-d-muramate
 
* molecular-weight:
 
** 676.397
 
* inchi-key:
 
** nqbrvzndbbmblj-mqtlhlsbsa-k
 
* smiles:
 
** cc(c([o-])=o)oc3(c(o)c(co)oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(nc(c)=o)3)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12647]]
 +
* [[RXN-14451]]
 +
* [[RXN-15451]]
 +
* [[RXN-15468]]
 +
* [[RXN-15815]]
 +
* [[RXN-15831]]
 +
* [[RXN-17758]]
 +
* [[RXN-924]]
 +
* [[RXN0-5244]]
 +
* [[RXN0-5245]]
 +
* [[RXN0-5248]]
 +
* [[RXN0-5254]]
 +
* [[RXN0-5257]]
 +
* [[RXN0-5259]]
 +
* [[RXN0-5265]]
 +
* [[RXN0-6490]]
 +
* [[RXN0-7005]]
 +
* [[RXN66-548]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-n-acetyl-α-d-muramate}}
 
{{#set: molecular-weight=676.397}}
 
{{#set: inchi-key=inchikey=nqbrvzndbbmblj-mqtlhlsbsa-k}}
 

Latest revision as of 19:36, 17 March 2021