Difference between revisions of "Very-long-chain-fatty-acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11444 == * common-name: ** uroporphyrinogen-i * molecular-weight: ** 828.742 * inchi-key: ** qttnoskslatgqb-uhfffaoysa-f * smiles: **...")
(Created page with "Category:metabolite == Metabolite Very-long-chain-fatty-acids == * common-name: ** a very-long-chain fatty acid == Reaction(s) known to consume the compound == * RXN-164...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-11444 ==
+
== Metabolite Very-long-chain-fatty-acids ==
 
* common-name:
 
* common-name:
−
** uroporphyrinogen-i
+
** a very-long-chain fatty acid
−
* molecular-weight:
 
−
** 828.742
 
−
* inchi-key:
 
−
** qttnoskslatgqb-uhfffaoysa-f
 
−
* smiles:
 
−
** c(=o)([o-])ccc5(=c4(nc(cc1(nc(=c(cc([o-])=o)c(ccc(=o)[o-])=1)cc2(nc(=c(c(ccc(=o)[o-])=2)cc(=o)[o-])cc3(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n3)c4))))=c(cc(=o)[o-])5))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-10642]]
+
* [[RXN-16415]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-14396]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=uroporphyrinogen-i}}
+
{{#set: common-name=a very-long-chain fatty acid}}
−
{{#set: molecular-weight=828.742}}
 
−
{{#set: inchi-key=inchikey=qttnoskslatgqb-uhfffaoysa-f}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite Very-long-chain-fatty-acids

  • common-name:
    • a very-long-chain fatty acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=Very-long-chain-fatty-acids&oldid=50029"