Difference between revisions of "Cis-Delta7-tetradecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-437 == * common-name: ** quercetin-3-glucoside * molecular-weight: ** 463.374 * inchi-key: ** ovsqvdmcbvzwgm-qsofnflrsa-m * smiles:...")
(Created page with "Category:metabolite == Metabolite Cis-Delta7-tetradecenoyl-ACPs == * common-name: ** a (7z)-tetradec-7-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-437 ==
+
== Metabolite Cis-Delta7-tetradecenoyl-ACPs ==
 
* common-name:
 
* common-name:
** quercetin-3-glucoside
+
** a (7z)-tetradec-7-enoyl-[acp]
* molecular-weight:
 
** 463.374
 
* inchi-key:
 
** ovsqvdmcbvzwgm-qsofnflrsa-m
 
* smiles:
 
** c1(c=c(o)c(o)=cc=1c3(oc4(c=c([o-])c=c(o)c(c(=o)c(oc2(oc(co)c(o)c(o)c(o)2))=3)=4)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10658]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-462]]
+
* [[RXN-10657]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=quercetin-3-glucoside}}
+
{{#set: common-name=a (7z)-tetradec-7-enoyl-[acp]}}
{{#set: molecular-weight=463.374}}
 
{{#set: inchi-key=inchikey=ovsqvdmcbvzwgm-qsofnflrsa-m}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite Cis-Delta7-tetradecenoyl-ACPs

  • common-name:
    • a (7z)-tetradec-7-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (7z)-tetradec-7-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.