Difference between revisions of "CPD-12482"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEHYDROSPHINGANINE == * common-name: ** 3-dehydrosphinganine * molecular-weight: ** 300.504 * inchi-key: ** kbunosoggaarkz-krwdzbqosa-o *...") |
(Created page with "Category:metabolite == Metabolite CPD-12482 == * common-name: ** 3,7-dimethylurate * molecular-weight: ** 196.165 * inchi-key: ** hmlzlhkhnblljd-uhfffaoysa-n * smiles: **...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-12482 == |
* common-name: | * common-name: | ||
− | ** 3- | + | ** 3,7-dimethylurate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 196.165 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hmlzlhkhnblljd-uhfffaoysa-n |
* smiles: | * smiles: | ||
− | ** | + | ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-11519]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=3- | + | {{#set: common-name=3,7-dimethylurate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=196.165}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hmlzlhkhnblljd-uhfffaoysa-n}} |
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite CPD-12482
- common-name:
- 3,7-dimethylurate
- molecular-weight:
- 196.165
- inchi-key:
- hmlzlhkhnblljd-uhfffaoysa-n
- smiles:
- cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2))