Difference between revisions of "CPD-11404"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CYCLOEUCALENOL == * common-name: ** cycloeucalenol * molecular-weight: ** 426.724 * inchi-key: ** hunltizknqdzei-zkzkkxeqsa-n * smiles: *...") |
(Created page with "Category:metabolite == Metabolite CPD-11404 == * common-name: ** 3,3',5-triiodothyroacetate * molecular-weight: ** 620.928 * inchi-key: ** uowzuvnaguaeqc-uhfffaoysa-m * sm...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11404 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3,3',5-triiodothyroacetate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 620.928 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uowzuvnaguaeqc-uhfffaoysa-m |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10618]] |
| + | * [[RXN-10619]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3,3',5-triiodothyroacetate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=620.928}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uowzuvnaguaeqc-uhfffaoysa-m}} |
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite CPD-11404
- common-name:
- 3,3',5-triiodothyroacetate
- molecular-weight:
- 620.928
- inchi-key:
- uowzuvnaguaeqc-uhfffaoysa-m
- smiles:
- c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2))
