Difference between revisions of "Alpha-D-Mannosides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3OH-4P-OH-ALPHA-KETOBUTYRATE == * common-name: ** (3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate * molecular-weight: ** 211.045 * inchi-key:...")
(Created page with "Category:metabolite == Metabolite Alpha-D-Mannosides == * common-name: ** an α-d-mannoside == Reaction(s) known to consume the compound == * 3.2.1.24-RXN == Reac...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3OH-4P-OH-ALPHA-KETOBUTYRATE ==
+
== Metabolite Alpha-D-Mannosides ==
 
* common-name:
 
* common-name:
** (3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate
+
** an α-d-mannoside
* molecular-weight:
 
** 211.045
 
* inchi-key:
 
** mzjfvxdtnbhtkz-uwtatzphsa-k
 
* smiles:
 
** c(c(c(c([o-])=o)=o)o)op([o-])(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PSERTRANSAMPYR-RXN]]
+
* [[3.2.1.24-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PSERTRANSAMPYR-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate}}
+
{{#set: common-name=an α-d-mannoside}}
{{#set: molecular-weight=211.045}}
 
{{#set: inchi-key=inchikey=mzjfvxdtnbhtkz-uwtatzphsa-k}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite Alpha-D-Mannosides

  • common-name:
    • an α-d-mannoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality