Difference between revisions of "Protein-L-Asparagine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-P-SERINE == * common-name: ** 3-phospho-l-serine * molecular-weight: ** 183.057 * inchi-key: ** bzqfbwgglxlepq-reohclbhsa-l * smiles: *...")
(Created page with "Category:metabolite == Metabolite Protein-L-Asparagine == * common-name: ** a [protein]-l-asparagine == Reaction(s) known to consume the compound == * 2.4.1.119-RXN *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-P-SERINE ==
+
== Metabolite Protein-L-Asparagine ==
 
* common-name:
 
* common-name:
** 3-phospho-l-serine
+
** a [protein]-l-asparagine
* molecular-weight:
 
** 183.057
 
* inchi-key:
 
** bzqfbwgglxlepq-reohclbhsa-l
 
* smiles:
 
** c(op([o-])([o-])=o)c([n+])c(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PSERTRANSAM-RXN]]
+
* [[2.4.1.119-RXN]]
* [[RXN0-5114]]
+
* [[2.4.1.94-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PSERTRANSAM-RXN]]
+
* [[2.4.1.94-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-phospho-l-serine}}
+
{{#set: common-name=a [protein]-l-asparagine}}
{{#set: molecular-weight=183.057}}
 
{{#set: inchi-key=inchikey=bzqfbwgglxlepq-reohclbhsa-l}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite Protein-L-Asparagine

  • common-name:
    • a [protein]-l-asparagine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-asparagine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.