Difference between revisions of "TRNA-pseudouridine-38-40"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12303 == * common-name: ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine * molecular-weight:...")
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine-38-40 == * common-name: ** a pseudouridine38-40 in trna == Reaction(s) known to consume the compound == == Reaction(s)...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12303 ==
+
== Metabolite tRNA-pseudouridine-38-40 ==
 
* common-name:
 
* common-name:
** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine
+
** a pseudouridine38-40 in trna
* molecular-weight:
 
** 1598.955
 
* inchi-key:
 
** kcrofjgxxschga-ygmfixcysa-k
 
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(op([o-])(=o)oc1(c(nc(=o)c)c(oc(c)c(=o)nc(c)c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc[n+])c(nc(c)c(=o)[o-])=o)c(o)c(co)o1))([o-])=o)c)c)c)c)c)c)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11347]]
+
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine}}
+
{{#set: common-name=a pseudouridine38-40 in trna}}
{{#set: molecular-weight=1598.955}}
 
{{#set: inchi-key=inchikey=kcrofjgxxschga-ygmfixcysa-k}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite tRNA-pseudouridine-38-40

  • common-name:
    • a pseudouridine38-40 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality