Difference between revisions of "Cytochromes-C-Reduced"

Latest revision as of 19:37, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P ==
+== Metabolite Cytochromes-C-Reduced ==
 * common-name:
-** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate
+** a reduced c-type cytochrome
-* molecular-weight:
-** 346.21
-* inchi-key:
-** qkmbynrmprkvto-mnovxskesa-k
-* smiles:
-** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cnc1(c=cc=cc(c(=o)[o-])=1)
 == Reaction(s) known to consume the compound ==
-* [[IGPSYN-RXN]]
+* [[1.10.2.2-RXN]]
+* [[CYTOCHROME-C-OXIDASE-RXN]]
+* [[RXN-15830]]
 == Reaction(s) known to produce the compound ==
-* [[PRAISOM-RXN]]
+* [[1.10.2.2-RXN]]
+* [[D-LACTATE-DEHYDROGENASE-CYTOCHROME-RXN]]
+* [[L-LACTATE-DEHYDROGENASE-CYTOCHROME-RXN]]
+* [[RXN-12876]]
+* [[RXN-14107]]
+* [[RXN-15815]]
+* [[RXN-15816]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate}}
+{{#set: common-name=a reduced c-type cytochrome}}
-{{#set: molecular-weight=346.21}}
-{{#set: inchi-key=inchikey=qkmbynrmprkvto-mnovxskesa-k}}