Difference between revisions of "ISOBUTYRYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9038 == * common-name: ** precorrin-1 * molecular-weight: ** 842.768 * inchi-key: ** cjlvuwulfkhgfb-nzcajupmsa-f * smiles: ** cc3(c4(...")
(Created page with "Category:metabolite == Metabolite ISOBUTYRYL-COA == * common-name: ** isobutanoyl-coa * molecular-weight: ** 833.593 * inchi-key: ** aewhywspvrzhct-ndzskpawsa-j * smiles:...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9038 ==
+
== Metabolite ISOBUTYRYL-COA ==
 
* common-name:
 
* common-name:
** precorrin-1
+
** isobutanoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 842.768
+
** 833.593
 
* inchi-key:
 
* inchi-key:
** cjlvuwulfkhgfb-nzcajupmsa-f
+
** aewhywspvrzhct-ndzskpawsa-j
 
* smiles:
 
* smiles:
** cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc([o-])=o)c=2ccc([o-])=o)cc(c3ccc(=o)[o-])=n4)))n5)cc([o-])=o)))(cc([o-])=o)
+
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8675]]
+
* [[2.3.1.168-RXN]]
 +
* [[MEPROPCOA-FAD-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UROPORIIIMETHYLTRANSA-RXN]]
+
* [[1.2.1.25-RXN]]
 +
* [[2.3.1.168-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=precorrin-1}}
+
{{#set: common-name=isobutanoyl-coa}}
{{#set: molecular-weight=842.768}}
+
{{#set: molecular-weight=833.593}}
{{#set: inchi-key=inchikey=cjlvuwulfkhgfb-nzcajupmsa-f}}
+
{{#set: inchi-key=inchikey=aewhywspvrzhct-ndzskpawsa-j}}

Latest revision as of 19:37, 17 March 2021

Metabolite ISOBUTYRYL-COA

  • common-name:
    • isobutanoyl-coa
  • molecular-weight:
    • 833.593
  • inchi-key:
    • aewhywspvrzhct-ndzskpawsa-j
  • smiles:
    • cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality