Difference between revisions of "ISOBUTYRYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9038 == * common-name: ** precorrin-1 * molecular-weight: ** 842.768 * inchi-key: ** cjlvuwulfkhgfb-nzcajupmsa-f * smiles: ** cc3(c4(...") |
(Created page with "Category:metabolite == Metabolite ISOBUTYRYL-COA == * common-name: ** isobutanoyl-coa * molecular-weight: ** 833.593 * inchi-key: ** aewhywspvrzhct-ndzskpawsa-j * smiles:...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ISOBUTYRYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** isobutanoyl-coa |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 833.593 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** aewhywspvrzhct-ndzskpawsa-j |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[2.3.1.168-RXN]] |
+ | * [[MEPROPCOA-FAD-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.2.1.25-RXN]] |
+ | * [[2.3.1.168-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=isobutanoyl-coa}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=833.593}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=aewhywspvrzhct-ndzskpawsa-j}} |
Latest revision as of 19:37, 17 March 2021
Contents
Metabolite ISOBUTYRYL-COA
- common-name:
- isobutanoyl-coa
- molecular-weight:
- 833.593
- inchi-key:
- aewhywspvrzhct-ndzskpawsa-j
- smiles:
- cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c