Difference between revisions of "CPD-18346"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8117 == * common-name: ** γ-linolenate * molecular-weight: ** 277.426 * inchi-key: ** vzccetwtmqhepk-qnebeihssa-m * smiles: **...")
(Created page with "Category:metabolite == Metabolite CPD-18346 == * common-name: ** cis-vaccenoyl-coa * molecular-weight: ** 1027.953 * inchi-key: ** hejoxxlscaqqgq-saiinbspsa-j * smiles: **...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8117 ==
+
== Metabolite CPD-18346 ==
 
* common-name:
 
* common-name:
** γ-linolenate
+
** cis-vaccenoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 277.426
+
** 1027.953
 
* inchi-key:
 
* inchi-key:
** vzccetwtmqhepk-qnebeihssa-m
+
** hejoxxlscaqqgq-saiinbspsa-j
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=cccccc(=o)[o-]
+
** ccccccc=ccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R07063]]
+
* [[RXN0-7238]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-linolenate}}
+
{{#set: common-name=cis-vaccenoyl-coa}}
{{#set: molecular-weight=277.426}}
+
{{#set: molecular-weight=1027.953}}
{{#set: inchi-key=inchikey=vzccetwtmqhepk-qnebeihssa-m}}
+
{{#set: inchi-key=inchikey=hejoxxlscaqqgq-saiinbspsa-j}}

Latest revision as of 19:37, 17 March 2021

Metabolite CPD-18346

  • common-name:
    • cis-vaccenoyl-coa
  • molecular-weight:
    • 1027.953
  • inchi-key:
    • hejoxxlscaqqgq-saiinbspsa-j
  • smiles:
    • ccccccc=ccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality