Difference between revisions of "CDP-2-3-4-Saturated-Diacylglycerols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17045 == * common-name: ** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine * molecular-weight: ** 266.253 * inchi-key: ** p...")
(Created page with "Category:metabolite == Metabolite CDP-2-3-4-Saturated-Diacylglycerols == * common-name: ** a cdp-2,3,4-saturated-diacylglycerol == Reaction(s) known to consume the compoun...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-17045 ==
+
== Metabolite CDP-2-3-4-Saturated-Diacylglycerols ==
 
* common-name:
 
* common-name:
−
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
+
** a cdp-2,3,4-saturated-diacylglycerol
−
* molecular-weight:
 
−
** 266.253
 
−
* inchi-key:
 
−
** pxypzmrmtkvysm-vxgbxaggsa-n
 
−
* smiles:
 
−
** c(o)c2(o)(nc(=o)c(o)(cc1(=cc=cc=c1))nc(=o)2)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-15680]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-5515]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=a cdp-2,3,4-saturated-diacylglycerol}}
−
{{#set: molecular-weight=266.253}}
 
−
{{#set: inchi-key=inchikey=pxypzmrmtkvysm-vxgbxaggsa-n}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite CDP-2-3-4-Saturated-Diacylglycerols

  • common-name:
    • a cdp-2,3,4-saturated-diacylglycerol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=CDP-2-3-4-Saturated-Diacylglycerols&oldid=50153"