Difference between revisions of "2-Lysophosphatidylcholines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA == * common-name: ** (2s,3s)-3-hydroxy-2-methylbutanoyl-coa * molecular-weight: ** 863.619 * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite 2-Lysophosphatidylcholines == * common-name: ** a 1-acyl-sn-glycero-3-phosphocholine == Reaction(s) known to consume the compound == * ...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA ==
+
== Metabolite 2-Lysophosphatidylcholines ==
 
* common-name:
 
* common-name:
** (2s,3s)-3-hydroxy-2-methylbutanoyl-coa
+
** a 1-acyl-sn-glycero-3-phosphocholine
* molecular-weight:
 
** 863.619
 
* inchi-key:
 
** pekyntfsobaabv-lqudnsjzsa-j
 
* smiles:
 
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c(c)o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.178-RXN]]
+
* [[2.3.1.23-RXN]]
* [[TIGLYLCOA-HYDROXY-RXN]]
+
* [[LYSOPHOSPHOLIPASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.178-RXN]]
+
* [[2.3.1.23-RXN]]
* [[TIGLYLCOA-HYDROXY-RXN]]
+
* [[RXN-1501_METACYC18.5]]
 +
* [[RXN-1641]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2s,3s)-3-hydroxy-2-methylbutanoyl-coa}}
+
{{#set: common-name=a 1-acyl-sn-glycero-3-phosphocholine}}
{{#set: molecular-weight=863.619}}
 
{{#set: inchi-key=inchikey=pekyntfsobaabv-lqudnsjzsa-j}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite 2-Lysophosphatidylcholines

  • common-name:
    • a 1-acyl-sn-glycero-3-phosphocholine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality