Difference between revisions of "2-Lysophosphatidylcholines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHENYL-PYRUVATE == * common-name: ** 3-phenyl-2-oxopropanoate * molecular-weight: ** 163.152 * inchi-key: ** btnmpgbkdvtsjy-uhfffaoysa-m...")
(Created page with "Category:metabolite == Metabolite 2-Lysophosphatidylcholines == * common-name: ** a 1-acyl-sn-glycero-3-phosphocholine == Reaction(s) known to consume the compound == * ...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHENYL-PYRUVATE ==
+
== Metabolite 2-Lysophosphatidylcholines ==
 
* common-name:
 
* common-name:
** 3-phenyl-2-oxopropanoate
+
** a 1-acyl-sn-glycero-3-phosphocholine
* molecular-weight:
 
** 163.152
 
* inchi-key:
 
** btnmpgbkdvtsjy-uhfffaoysa-m
 
* smiles:
 
** c([o-])(=o)c(=o)cc1(=cc=cc=c1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.6.1.58-RXN]]
+
* [[2.3.1.23-RXN]]
* [[PHEAMINOTRANS-RXN]]
+
* [[LYSOPHOSPHOLIPASE-RXN]]
* [[PHENYLPYRUVATE-TAUTOMERASE-RXN]]
 
* [[PREPHENATEDEHYDRAT-RXN]]
 
* [[RXN-10814]]
 
* [[RXN-10815]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.6.1.58-RXN]]
+
* [[2.3.1.23-RXN]]
* [[PHEAMINOTRANS-RXN]]
+
* [[RXN-1501_METACYC18.5]]
* [[PREPHENATEDEHYDRAT-RXN]]
+
* [[RXN-1641]]
* [[RXN-10814]]
 
* [[RXN-17130]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-phenyl-2-oxopropanoate}}
+
{{#set: common-name=a 1-acyl-sn-glycero-3-phosphocholine}}
{{#set: molecular-weight=163.152}}
 
{{#set: inchi-key=inchikey=btnmpgbkdvtsjy-uhfffaoysa-m}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite 2-Lysophosphatidylcholines

  • common-name:
    • a 1-acyl-sn-glycero-3-phosphocholine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality