Difference between revisions of "CPD-9700"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-form-FeS-Cluster-Scaffold-Proteins == * common-name: ** a [disordered-form [fe-s] cluster scaffold protein] == Reaction(s) known to con...") |
(Created page with "Category:metabolite == Metabolite CPD-9700 == * common-name: ** hypoglycin b * molecular-weight: ** 269.277 * inchi-key: ** uydzycpiqsrxku-nppuscpjsa-m * smiles: ** c=c1(c...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9700 == |
* common-name: | * common-name: | ||
| − | ** | + | ** hypoglycin b |
| + | * molecular-weight: | ||
| + | ** 269.277 | ||
| + | * inchi-key: | ||
| + | ** uydzycpiqsrxku-nppuscpjsa-m | ||
| + | * smiles: | ||
| + | ** c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9157]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=hypoglycin b}} |
| + | {{#set: molecular-weight=269.277}} | ||
| + | {{#set: inchi-key=inchikey=uydzycpiqsrxku-nppuscpjsa-m}} | ||
Latest revision as of 19:37, 17 March 2021
Contents
Metabolite CPD-9700
- common-name:
- hypoglycin b
- molecular-weight:
- 269.277
- inchi-key:
- uydzycpiqsrxku-nppuscpjsa-m
- smiles:
- c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1)
