Difference between revisions of "CPD-11555"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-phospho-ligated-tRNA == * common_name: ** a 2'-phospho-[ligated trna] == Reaction(s) known to consume the compound == * 2.7.1.160-RXN...") |
(Created page with "Category:metabolite == Metabolite CPD-11555 == * common_name: ** octoketide * smiles: ** cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3)) * inchi_key: ** inchik...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-11555 == |
* common_name: | * common_name: | ||
− | ** | + | ** octoketide |
+ | * smiles: | ||
+ | ** cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3)) | ||
+ | * inchi_key: | ||
+ | ** inchikey=wfnzgunbscuxfx-uhfffaoysa-m | ||
+ | * molecular_weight: | ||
+ | ** 317.274 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-10734]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common_name= | + | {{#set: common_name=octoketide}} |
+ | {{#set: inchi_key=inchikey=wfnzgunbscuxfx-uhfffaoysa-m}} | ||
+ | {{#set: molecular_weight=317.274 }} |
Latest revision as of 19:37, 17 March 2021
Contents
Metabolite CPD-11555
- common_name:
- octoketide
- smiles:
- cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3))
- inchi_key:
- inchikey=wfnzgunbscuxfx-uhfffaoysa-m
- molecular_weight:
- 317.274