Difference between revisions of "CPD-11555"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-674 == * common-name: ** trans-cinnamate * molecular-weight: ** 147.153 * inchi-key: ** wbywaxjhaxsjni-votsokgwsa-m * smiles: ** c(=o...") |
(Created page with "Category:metabolite == Metabolite CPD-11555 == * common_name: ** octoketide * smiles: ** cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3)) * inchi_key: ** inchik...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-11555 == |
| − | * | + | * common_name: |
| − | ** | + | ** octoketide |
| − | |||
| − | |||
| − | |||
| − | |||
* smiles: | * smiles: | ||
| − | ** c(=o)([o-])c= | + | ** cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3)) |
| + | * inchi_key: | ||
| + | ** inchikey=wfnzgunbscuxfx-uhfffaoysa-m | ||
| + | * molecular_weight: | ||
| + | ** 317.274 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10734]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common_name=octoketide}} |
| − | {{#set: | + | {{#set: inchi_key=inchikey=wfnzgunbscuxfx-uhfffaoysa-m}} |
| − | {{#set: | + | {{#set: molecular_weight=317.274 }} |
Latest revision as of 19:37, 17 March 2021
Contents
Metabolite CPD-11555
- common_name:
- octoketide
- smiles:
- cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3))
- inchi_key:
- inchikey=wfnzgunbscuxfx-uhfffaoysa-m
- molecular_weight:
- 317.274
