Difference between revisions of "CPD-11555"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CYS-tRNAs == * common-name: ** a trnacys == Reaction(s) known to consume the compound == * CYSTEINE--TRNA-LIGASE-RXN == Reaction(s) k...")
 
(Created page with "Category:metabolite == Metabolite CPD-11555 == * common_name: ** octoketide * smiles: ** cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3)) * inchi_key: ** inchik...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CYS-tRNAs ==
+
== Metabolite CPD-11555 ==
* common-name:
+
* common_name:
** a trnacys
+
** octoketide
 +
* smiles:
 +
** cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3))
 +
* inchi_key:
 +
** inchikey=wfnzgunbscuxfx-uhfffaoysa-m
 +
* molecular_weight:
 +
** 317.274   
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYSTEINE--TRNA-LIGASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16637]]
+
* [[RXN-10734]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trnacys}}
+
{{#set: common_name=octoketide}}
 +
{{#set: inchi_key=inchikey=wfnzgunbscuxfx-uhfffaoysa-m}}
 +
{{#set: molecular_weight=317.274    }}

Latest revision as of 19:37, 17 March 2021

Metabolite CPD-11555

  • common_name:
    • octoketide
  • smiles:
    • cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3))
  • inchi_key:
    • inchikey=wfnzgunbscuxfx-uhfffaoysa-m
  • molecular_weight:
    • 317.274

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality