Difference between revisions of "N-Substituted-Amino-Acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHYTYL-PYROPHOSPHATE == * common-name: ** phytyl diphosphate * molecular-weight: ** 453.471 * inchi-key: ** itplbnccpzsweu-pyddkjgssa-k *...")
(Created page with "Category:metabolite == Metabolite N-Substituted-Amino-Acids == * common-name: ** an n-modified amino acid == Reaction(s) known to consume the compound == == Reaction(s) kn...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHYTYL-PYROPHOSPHATE ==
+
== Metabolite N-Substituted-Amino-Acids ==
 
* common-name:
 
* common-name:
** phytyl diphosphate
+
** an n-modified amino acid
* molecular-weight:
 
** 453.471
 
* inchi-key:
 
** itplbnccpzsweu-pyddkjgssa-k
 
* smiles:
 
** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2541]]
 
* [[RXN-7674]]
 
* [[RXN1F-66]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10625]]
+
* [[AMINOCYL-TRNA-HYDROLASE-RXN]]
* [[RXN1F-66]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phytyl diphosphate}}
+
{{#set: common-name=an n-modified amino acid}}
{{#set: molecular-weight=453.471}}
 
{{#set: inchi-key=inchikey=itplbnccpzsweu-pyddkjgssa-k}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite N-Substituted-Amino-Acids

  • common-name:
    • an n-modified amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality