Difference between revisions of "CPD-85"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-BETA-ASPARTYL-P == * common-name: ** l-aspartyl-4-phosphate * molecular-weight: ** 211.068 * inchi-key: ** ixznktpiykdigg-reohclbhsa-l...")
 
(Created page with "Category:metabolite == Metabolite CPD-85 == * common-name: ** 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one * molecular-weight: ** 161.195 * inchi-key: ** cilxjjlqptuuss...")
 
(3 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-BETA-ASPARTYL-P ==
+
== Metabolite CPD-85 ==
 
* common-name:
 
* common-name:
** l-aspartyl-4-phosphate
+
** 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
 
* molecular-weight:
 
* molecular-weight:
** 211.068
+
** 161.195
 
* inchi-key:
 
* inchi-key:
** ixznktpiykdigg-reohclbhsa-l
+
** cilxjjlqptuuss-xqrvvysfsa-m
 
* smiles:
 
* smiles:
** c(c([n+])c(=o)[o-])c(=o)op([o-])(=o)[o-]
+
** csccc(c([o-])=co)=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
+
* [[R147-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
+
* [[3.1.3.77-RXN]]
* [[ASPARTATEKIN-RXN]]
+
* [[R83-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-aspartyl-4-phosphate}}
+
{{#set: common-name=1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one}}
{{#set: molecular-weight=211.068}}
+
{{#set: molecular-weight=161.195}}
{{#set: inchi-key=inchikey=ixznktpiykdigg-reohclbhsa-l}}
+
{{#set: inchi-key=inchikey=cilxjjlqptuuss-xqrvvysfsa-m}}

Latest revision as of 19:37, 17 March 2021

Metabolite CPD-85

  • common-name:
    • 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
  • molecular-weight:
    • 161.195
  • inchi-key:
    • cilxjjlqptuuss-xqrvvysfsa-m
  • smiles:
    • csccc(c([o-])=co)=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality