Difference between revisions of "L-1-phosphatidyl-inositols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9864 == * common-name: ** 3-decaprenyl-4-hydroxybenzoate * molecular-weight: ** 818.297 * inchi-key: ** cmpnjzrebhcphn-ltnibbdrsa-m *...")
(Created page with "Category:metabolite == Metabolite L-1-phosphatidyl-inositols == * common-name: ** a 1-phosphatidyl-1d-myo-inositol == Reaction(s) known to consume the compound == * 1-PH...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9864 ==
+
== Metabolite L-1-phosphatidyl-inositols ==
 
* common-name:
 
* common-name:
** 3-decaprenyl-4-hydroxybenzoate
+
** a 1-phosphatidyl-1d-myo-inositol
* molecular-weight:
 
** 818.297
 
* inchi-key:
 
** cmpnjzrebhcphn-ltnibbdrsa-m
 
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c)c)c)c)c)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN]]
 +
* [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]]
 +
* [[2.4.1.198-RXN]]
 +
* [[PHOSPHATIDYLINOSITOL-DEACYLASE-RXN]]
 +
* [[RXN-16261]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9230]]
+
* [[2.4.1.198-RXN]]
 +
* [[2.7.8.11-RXN]]
 +
* [[PHOSPHATIDYLINOSITOL-3-PHOSPHATASE-RXN]]
 +
* [[RXN-10961]]
 +
* [[RXN-10962]]
 +
* [[RXN-16261]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-decaprenyl-4-hydroxybenzoate}}
+
{{#set: common-name=a 1-phosphatidyl-1d-myo-inositol}}
{{#set: molecular-weight=818.297}}
 
{{#set: inchi-key=inchikey=cmpnjzrebhcphn-ltnibbdrsa-m}}
 

Latest revision as of 19:37, 17 March 2021