Difference between revisions of "Orthophosphoric-Monoesters"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MALTOTRIOSE == * common-name: ** maltotriose * molecular-weight: ** 504.441 * inchi-key: ** fygdtmlnykfzsv-dzoucchmsa-n * smiles: ** c(c1...")
(Created page with "Category:metabolite == Metabolite Orthophosphoric-Monoesters == * common-name: ** a phosphate monoester == Reaction(s) known to consume the compound == * ACID-PHOSPHATAS...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MALTOTRIOSE ==
+
== Metabolite Orthophosphoric-Monoesters ==
 
* common-name:
 
* common-name:
** maltotriose
+
** a phosphate monoester
* molecular-weight:
 
** 504.441
 
* inchi-key:
 
** fygdtmlnykfzsv-dzoucchmsa-n
 
* smiles:
 
** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ACID-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5182]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=maltotriose}}
+
{{#set: common-name=a phosphate monoester}}
{{#set: molecular-weight=504.441}}
 
{{#set: inchi-key=inchikey=fygdtmlnykfzsv-dzoucchmsa-n}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite Orthophosphoric-Monoesters

  • common-name:
    • a phosphate monoester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality