Difference between revisions of "CPD-9459"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-787 == * common-name: ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate * molecular-weight: ** 170.121 * inchi-key: ** zbcbetmbsdtinl-nwjcxac...")
(Created page with "Category:metabolite == Metabolite CPD-9459 == * common-name: ** oleanolate * molecular-weight: ** 455.699 * inchi-key: ** mijyxulnpsfwek-gtofxwbisa-m * smiles: ** cc3(c[ch...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-787 ==
+
== Metabolite CPD-9459 ==
 
* common-name:
 
* common-name:
** (2z,4z)-2-hydroxyhepta-2,4-dienedioate
+
** oleanolate
 
* molecular-weight:
 
* molecular-weight:
** 170.121
+
** 455.699
 
* inchi-key:
 
* inchi-key:
** zbcbetmbsdtinl-nwjcxacmsa-l
+
** mijyxulnpsfwek-gtofxwbisa-m
 
* smiles:
 
* smiles:
** c([o-])(=o)cc=cc=c(o)c(=o)[o-]
+
** cc3(c[ch]4(c2(=cc[ch]5(c1(ccc(c([ch]1ccc(c2(ccc(cc3)4c([o-])=o)c)5c)(c)c)o)c))))c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1K-87]]
+
* [[RXN-9000]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2z,4z)-2-hydroxyhepta-2,4-dienedioate}}
+
{{#set: common-name=oleanolate}}
{{#set: molecular-weight=170.121}}
+
{{#set: molecular-weight=455.699}}
{{#set: inchi-key=inchikey=zbcbetmbsdtinl-nwjcxacmsa-l}}
+
{{#set: inchi-key=inchikey=mijyxulnpsfwek-gtofxwbisa-m}}

Latest revision as of 19:37, 17 March 2021

Metabolite CPD-9459

  • common-name:
    • oleanolate
  • molecular-weight:
    • 455.699
  • inchi-key:
    • mijyxulnpsfwek-gtofxwbisa-m
  • smiles:
    • cc3(c[ch]4(c2(=cc[ch]5(c1(ccc(c([ch]1ccc(c2(ccc(cc3)4c([o-])=o)c)5c)(c)c)o)c))))c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality