Difference between revisions of "MAPKK-L-serine-or-L-threonine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PYRIDOXAMINE-5P == * common-name: ** pyridoxamine 5'-phosphate * molecular-weight: ** 247.167 * inchi-key: ** zmjgsosnspkhnh-uhfffaoysa-m...")
(Created page with "Category:metabolite == Metabolite MAPKK-L-serine-or-L-threonine == * common-name: ** a [map kinase kinase]-(l-serine/l-threonine) == Reaction(s) known to consume the compo...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PYRIDOXAMINE-5P ==
+
== Metabolite MAPKK-L-serine-or-L-threonine ==
 
* common-name:
 
* common-name:
** pyridoxamine 5'-phosphate
+
** a [map kinase kinase]-(l-serine/l-threonine)
* molecular-weight:
 
** 247.167
 
* inchi-key:
 
** zmjgsosnspkhnh-uhfffaoysa-m
 
* smiles:
 
** cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PMPOXI-RXN]]
+
* [[2.7.11.25-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PYRAMKIN-RXN]]
+
* [[2.7.11.25-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pyridoxamine 5'-phosphate}}
+
{{#set: common-name=a [map kinase kinase]-(l-serine/l-threonine)}}
{{#set: molecular-weight=247.167}}
 
{{#set: inchi-key=inchikey=zmjgsosnspkhnh-uhfffaoysa-m}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite MAPKK-L-serine-or-L-threonine

  • common-name:
    • a [map kinase kinase]-(l-serine/l-threonine)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [map kinase kinase]-(l-serine/l-threonine)" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.