Difference between revisions of "CPD0-2354"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19161 == * common-name: ** (2e,7z)-tetradecenoyl-coa * molecular-weight: ** 969.83 * inchi-key: ** mwksuvqqmpjtpp-dtpvmwfysa-j * smil...")
(Created page with "Category:metabolite == Metabolite CPD0-2354 == * common-name: ** a trna precursor with a 5' extension == Reaction(s) known to consume the compound == * RXN0-6480 == Re...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19161 ==
+
== Metabolite CPD0-2354 ==
 
* common-name:
 
* common-name:
** (2e,7z)-tetradecenoyl-coa
+
** a trna precursor with a 5' extension
* molecular-weight:
 
** 969.83
 
* inchi-key:
 
** mwksuvqqmpjtpp-dtpvmwfysa-j
 
* smiles:
 
** ccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17793]]
+
* [[RXN0-6480]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,7z)-tetradecenoyl-coa}}
+
{{#set: common-name=a trna precursor with a 5' extension}}
{{#set: molecular-weight=969.83}}
 
{{#set: inchi-key=inchikey=mwksuvqqmpjtpp-dtpvmwfysa-j}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite CPD0-2354

  • common-name:
    • a trna precursor with a 5' extension

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality