Difference between revisions of "Alpha-D-Galactosides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FMN == * common-name: ** fmn * molecular-weight: ** 453.324 * inchi-key: ** ankzybdxhmzbdk-scrdcrapsa-k * smiles: ** cc2(=cc1(n=c3(c(=o)[...")
(Created page with "Category:metabolite == Metabolite Alpha-D-Galactosides == * common-name: ** an α-d-galactoside == Reaction(s) known to consume the compound == * RXN-12088 == Rea...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FMN ==
+
== Metabolite Alpha-D-Galactosides ==
 
* common-name:
 
* common-name:
** fmn
+
** an α-d-galactoside
* molecular-weight:
 
** 453.324
 
* inchi-key:
 
** ankzybdxhmzbdk-scrdcrapsa-k
 
* smiles:
 
** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FADSYN-RXN]]
+
* [[RXN-12088]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RIBOFLAVINKIN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=fmn}}
+
{{#set: common-name=an α-d-galactoside}}
{{#set: molecular-weight=453.324}}
 
{{#set: inchi-key=inchikey=ankzybdxhmzbdk-scrdcrapsa-k}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite Alpha-D-Galactosides

  • common-name:
    • an α-d-galactoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality