Difference between revisions of "ACETOACETYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-465 == * common-name: ** presqualene diphosphate * molecular-weight: ** 583.66 * inchi-key: ** atzkauggnmsccy-qlydttawsa-k * smiles:...") |
(Created page with "Category:metabolite == Metabolite ACETOACETYL-COA == * common-name: ** acetoacetyl-coa * molecular-weight: ** 847.577 * inchi-key: ** ojfdkhtzouzbos-citakdkdsa-j * smiles:...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ACETOACETYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** acetoacetyl-coa |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 847.577 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ojfdkhtzouzbos-citakdkdsa-j |
* smiles: | * smiles: | ||
− | ** cc(= | + | ** cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN]] |
− | * [[ | + | * [[ACETYL-COA-ACETYLTRANSFER-RXN]] |
+ | * [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]] | ||
+ | * [[RXN-11662]] | ||
+ | * [[RXN-5901]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ACETYL-COA-ACETYLTRANSFER-RXN]] |
+ | * [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]] | ||
+ | * [[RXN-11662]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=acetoacetyl-coa}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=847.577}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ojfdkhtzouzbos-citakdkdsa-j}} |
Latest revision as of 19:37, 17 March 2021
Contents
Metabolite ACETOACETYL-COA
- common-name:
- acetoacetyl-coa
- molecular-weight:
- 847.577
- inchi-key:
- ojfdkhtzouzbos-citakdkdsa-j
- smiles:
- cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
Reaction(s) known to consume the compound
- 3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN
- ACETYL-COA-ACETYLTRANSFER-RXN
- HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN
- RXN-11662
- RXN-5901