Difference between revisions of "ACETOACETYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-465 == * common-name: ** presqualene diphosphate * molecular-weight: ** 583.66 * inchi-key: ** atzkauggnmsccy-qlydttawsa-k * smiles:...")
(Created page with "Category:metabolite == Metabolite ACETOACETYL-COA == * common-name: ** acetoacetyl-coa * molecular-weight: ** 847.577 * inchi-key: ** ojfdkhtzouzbos-citakdkdsa-j * smiles:...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-465 ==
+
== Metabolite ACETOACETYL-COA ==
 
* common-name:
 
* common-name:
** presqualene diphosphate
+
** acetoacetyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 583.66
+
** 847.577
 
* inchi-key:
 
* inchi-key:
** atzkauggnmsccy-qlydttawsa-k
+
** ojfdkhtzouzbos-citakdkdsa-j
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-])=o))c)c)c
+
** cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13724]]
+
* [[3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN]]
* [[RXN66-281]]
+
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
* [[RXN-11662]]
 +
* [[RXN-5901]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12263]]
+
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
* [[RXN-11662]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=presqualene diphosphate}}
+
{{#set: common-name=acetoacetyl-coa}}
{{#set: molecular-weight=583.66}}
+
{{#set: molecular-weight=847.577}}
{{#set: inchi-key=inchikey=atzkauggnmsccy-qlydttawsa-k}}
+
{{#set: inchi-key=inchikey=ojfdkhtzouzbos-citakdkdsa-j}}

Latest revision as of 19:37, 17 March 2021

Metabolite ACETOACETYL-COA

  • common-name:
    • acetoacetyl-coa
  • molecular-weight:
    • 847.577
  • inchi-key:
    • ojfdkhtzouzbos-citakdkdsa-j
  • smiles:
    • cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality