Difference between revisions of "FERRICYTOCHROME-B5"

Latest revision as of 19:37, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-19172 ==
+== Metabolite FERRICYTOCHROME-B5 ==
 * common-name:
-** (2e,9z)-octadecenoyl-coa
+** a ferricytochrome b5
-* molecular-weight:
-** 1025.937
-* inchi-key:
-** reoymonhghuley-ppsvnwdxsa-j
-* smiles:
-** ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 == Reaction(s) known to consume the compound ==
-* [[RXN-17776]]
+* [[CYTOCHROME-B5-REDUCTASE-RXN]]
+* [[ExchangeSeed-FERRICYTOCHROME-B5]]
+* [[TransportSeed-FERRICYTOCHROME-B5]]
 == Reaction(s) known to produce the compound ==
+* [[1.14.19.1-RXN]]
+* [[1.14.99.33-RXN]]
+* [[ExchangeSeed-FERRICYTOCHROME-B5]]
+* [[RXN-10664]]
+* [[RXN-11887]]
+* [[RXN-13709]]
+* [[RXN-16132]]
+* [[RXN-17105]]
+* [[RXN-21829]]
+* [[RXN-4209]]
+* [[RXN-9601]]
+* [[RXN3O-218]]
+* [[TransportSeed-FERRICYTOCHROME-B5]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(2e,9z)-octadecenoyl-coa}}
+{{#set: common-name=a ferricytochrome b5}}
-{{#set: molecular-weight=1025.937}}
-{{#set: inchi-key=inchikey=reoymonhghuley-ppsvnwdxsa-j}}