Difference between revisions of "3-oxo-cerotoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DOPAQUINONE == * common-name: ** dopaquinone * molecular-weight: ** 195.174 * inchi-key: ** ahmiduvksgchau-lurjtmiesa-n * smiles: ** c([o...")
(Created page with "Category:metabolite == Metabolite 3-oxo-cerotoyl-ACPs == * common-name: ** a 3-oxohexacosanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-10060 == Rea...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DOPAQUINONE ==
+
== Metabolite 3-oxo-cerotoyl-ACPs ==
 
* common-name:
 
* common-name:
** dopaquinone
+
** a 3-oxohexacosanoyl-[acp]
* molecular-weight:
 
** 195.174
 
* inchi-key:
 
** ahmiduvksgchau-lurjtmiesa-n
 
* smiles:
 
** c([o-])(=o)c([n+])cc1(=cc(=o)c(=o)c=c1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11369]]
+
* [[RXN-10060]]
* [[RXN-8483]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MONOPHENOL-MONOOXYGENASE-RXN]]
+
* [[RXN-10059]]
* [[RXN-13061]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dopaquinone}}
+
{{#set: common-name=a 3-oxohexacosanoyl-[acp]}}
{{#set: molecular-weight=195.174}}
 
{{#set: inchi-key=inchikey=ahmiduvksgchau-lurjtmiesa-n}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite 3-oxo-cerotoyl-ACPs

  • common-name:
    • a 3-oxohexacosanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxohexacosanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.