Difference between revisions of "CPD-19172"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FRUCTOSE-6P == * common-name: ** β-d-fructofuranose 6-phosphate * molecular-weight: ** 258.121 * inchi-key: ** bgwgxpapygqalx-arqdhw...") |
(Created page with "Category:metabolite == Metabolite CPD-19172 == * common-name: ** (2e,9z)-octadecenoyl-coa * molecular-weight: ** 1025.937 * inchi-key: ** reoymonhghuley-ppsvnwdxsa-j * smi...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19172 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2e,9z)-octadecenoyl-coa |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 1025.937 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** reoymonhghuley-ppsvnwdxsa-j |
* smiles: | * smiles: | ||
| − | ** c(op(=o)([o-])[o-]) | + | ** ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17776]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2e,9z)-octadecenoyl-coa}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=1025.937}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=reoymonhghuley-ppsvnwdxsa-j}} |
Latest revision as of 19:37, 17 March 2021
Contents
Metabolite CPD-19172
- common-name:
- (2e,9z)-octadecenoyl-coa
- molecular-weight:
- 1025.937
- inchi-key:
- reoymonhghuley-ppsvnwdxsa-j
- smiles:
- ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
