Difference between revisions of "CPD-19172"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Protein-Tyrosines == * common-name: ** a [protein]-l-tyrosine == Reaction(s) known to consume the compound == * 2.7.10.1-RXN == React...")
(Created page with "Category:metabolite == Metabolite CPD-19172 == * common-name: ** (2e,9z)-octadecenoyl-coa * molecular-weight: ** 1025.937 * inchi-key: ** reoymonhghuley-ppsvnwdxsa-j * smi...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Protein-Tyrosines ==
+
== Metabolite CPD-19172 ==
 
* common-name:
 
* common-name:
** a [protein]-l-tyrosine
+
** (2e,9z)-octadecenoyl-coa
 +
* molecular-weight:
 +
** 1025.937
 +
* inchi-key:
 +
** reoymonhghuley-ppsvnwdxsa-j
 +
* smiles:
 +
** ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.10.1-RXN]]
+
* [[RXN-17776]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein]-l-tyrosine}}
+
{{#set: common-name=(2e,9z)-octadecenoyl-coa}}
 +
{{#set: molecular-weight=1025.937}}
 +
{{#set: inchi-key=inchikey=reoymonhghuley-ppsvnwdxsa-j}}

Latest revision as of 19:37, 17 March 2021

Metabolite CPD-19172

  • common-name:
    • (2e,9z)-octadecenoyl-coa
  • molecular-weight:
    • 1025.937
  • inchi-key:
    • reoymonhghuley-ppsvnwdxsa-j
  • smiles:
    • ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality