Difference between revisions of "PHOSPHORYL-ETHANOLAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE == * common-name: ** 2-c-methyl-d-erythritol-2,4-cyclodiphosphate * molecular-weight: ** 276.076 *...")
(Created page with "Category:metabolite == Metabolite PHOSPHORYL-ETHANOLAMINE == * common-name: ** o-phosphoethanolamine * molecular-weight: ** 140.055 * inchi-key: ** suhootkupisobe-uhfffaoy...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE ==
+
== Metabolite PHOSPHORYL-ETHANOLAMINE ==
 
* common-name:
 
* common-name:
** 2-c-methyl-d-erythritol-2,4-cyclodiphosphate
+
** o-phosphoethanolamine
 
* molecular-weight:
 
* molecular-weight:
** 276.076
+
** 140.055
 
* inchi-key:
 
* inchi-key:
** sfrqrnjmiiuydi-uhnvwzdzsa-l
+
** suhootkupisobe-uhfffaoysa-m
 
* smiles:
 
* smiles:
** cc1(co)(op(=o)([o-])op(=o)([o-])occ(o)1)
+
** c(c[n+])op([o-])([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-882]]
+
* [[2.7.7.14-RXN]]
 +
* [[RXN-7948]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-302]]
+
* [[ETHANOLAMINE-KINASE-RXN]]
 +
* [[RXN-13729]]
 +
* [[RXN3DJ-11230]]
 +
* [[SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-c-methyl-d-erythritol-2,4-cyclodiphosphate}}
+
{{#set: common-name=o-phosphoethanolamine}}
{{#set: molecular-weight=276.076}}
+
{{#set: molecular-weight=140.055}}
{{#set: inchi-key=inchikey=sfrqrnjmiiuydi-uhnvwzdzsa-l}}
+
{{#set: inchi-key=inchikey=suhootkupisobe-uhfffaoysa-m}}

Latest revision as of 19:37, 17 March 2021

Metabolite PHOSPHORYL-ETHANOLAMINE

  • common-name:
    • o-phosphoethanolamine
  • molecular-weight:
    • 140.055
  • inchi-key:
    • suhootkupisobe-uhfffaoysa-m
  • smiles:
    • c(c[n+])op([o-])([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality