Difference between revisions of "Protein-N-terminal-L-Arginine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-D-XYLOSE == * common-name: ** udp-α-d-xylose * molecular-weight: ** 534.263 * inchi-key: ** dqqdlyvhotzlor-ocimbmbzsa-l * smile...")
(Created page with "Category:metabolite == Metabolite Protein-N-terminal-L-Arginine == * common-name: ** an n-terminal arginyl-[protein] == Reaction(s) known to consume the compound == == Rea...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-D-XYLOSE ==
+
== Metabolite Protein-N-terminal-L-Arginine ==
 
* common-name:
 
* common-name:
** udp-α-d-xylose
+
** an n-terminal arginyl-[protein]
* molecular-weight:
 
** 534.263
 
* inchi-key:
 
** dqqdlyvhotzlor-ocimbmbzsa-l
 
* smiles:
 
** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(o)3)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.2.26-RXN]]
 
* [[2.7.7.11-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.7.11-RXN]]
+
* [[ARGINYLTRANSFERASE-RXN]]
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-α-d-xylose}}
+
{{#set: common-name=an n-terminal arginyl-[protein]}}
{{#set: molecular-weight=534.263}}
 
{{#set: inchi-key=inchikey=dqqdlyvhotzlor-ocimbmbzsa-l}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite Protein-N-terminal-L-Arginine

  • common-name:
    • an n-terminal arginyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal arginyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.