Difference between revisions of "CPD-13695"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NICOTINAMIDE_RIBOSE == * common-name: ** 1-(β-d ribofuranosyl)nicotinamide * molecular-weight: ** 255.25 * inchi-key: ** jlebzpbdrkp...")
 
(Created page with "Category:metabolite == Metabolite CPD-13695 == * common-name: ** 3,24-dioxocholest-4-en-26-oyl-coa * molecular-weight: ** 1174.098 * inchi-key: ** zvfuugbgzmbuan-kznrqmkss...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NICOTINAMIDE_RIBOSE ==
+
== Metabolite CPD-13695 ==
 
* common-name:
 
* common-name:
** 1-(β-d ribofuranosyl)nicotinamide
+
** 3,24-dioxocholest-4-en-26-oyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 255.25
+
** 1174.098
 
* inchi-key:
 
* inchi-key:
** jlebzpbdrkpwtd-turqnecasa-o
+
** zvfuugbgzmbuan-kznrqmkssa-j
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
+
** cc(ccc(=o)c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c)[ch]6(cc[ch]7([ch]5(ccc4(=cc(=o)ccc(c)4[ch]5ccc(c)67))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5841]]
+
* [[RXN-12705]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-(β-d ribofuranosyl)nicotinamide}}
+
{{#set: common-name=3,24-dioxocholest-4-en-26-oyl-coa}}
{{#set: molecular-weight=255.25}}
+
{{#set: molecular-weight=1174.098}}
{{#set: inchi-key=inchikey=jlebzpbdrkpwtd-turqnecasa-o}}
+
{{#set: inchi-key=inchikey=zvfuugbgzmbuan-kznrqmkssa-j}}

Latest revision as of 19:37, 17 March 2021

Metabolite CPD-13695

  • common-name:
    • 3,24-dioxocholest-4-en-26-oyl-coa
  • molecular-weight:
    • 1174.098
  • inchi-key:
    • zvfuugbgzmbuan-kznrqmkssa-j
  • smiles:
    • cc(ccc(=o)c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c)[ch]6(cc[ch]7([ch]5(ccc4(=cc(=o)ccc(c)4[ch]5ccc(c)67))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality