Difference between revisions of "D-Glucopyranuronate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3041 == * common-name: ** isoliquiritigenin * molecular-weight: ** 256.257 * inchi-key: ** dxdrhhkmwqzjht-fpygclrlsa-n * smiles: ** c...")
 
(Created page with "Category:metabolite == Metabolite D-Glucopyranuronate == * common-name: ** d-glucopyranuronate == Reaction(s) known to consume the compound == * RXN-14693 == Reaction(...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3041 ==
+
== Metabolite D-Glucopyranuronate ==
 
* common-name:
 
* common-name:
** isoliquiritigenin
+
** d-glucopyranuronate
* molecular-weight:
 
** 256.257
 
* inchi-key:
 
** dxdrhhkmwqzjht-fpygclrlsa-n
 
* smiles:
 
** c2(c=c(o)c=cc(c=cc(=o)c1(c(=cc(o)=cc=1)o))=2)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-3221]]
+
* [[RXN-14693]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-3142]]
+
* [[MYO-INOSITOL-OXYGENASE-RXN]]
 +
* [[RXN-14693]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=isoliquiritigenin}}
+
{{#set: common-name=d-glucopyranuronate}}
{{#set: molecular-weight=256.257}}
 
{{#set: inchi-key=inchikey=dxdrhhkmwqzjht-fpygclrlsa-n}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite D-Glucopyranuronate

  • common-name:
    • d-glucopyranuronate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality