Difference between revisions of "Charged-fMET-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite XANTHOSINE-5-PHOSPHATE == * common-name: ** xmp * molecular-weight: ** 362.192 * inchi-key: ** dctlyfzhfgencw-uuokfmhzsa-l * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite Charged-fMET-tRNAs == * common-name: ** an n-formyl-l-methionylaminoacyl-trna == Reaction(s) known to consume the compound == * 3.5.1.2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite XANTHOSINE-5-PHOSPHATE ==
+
== Metabolite Charged-fMET-tRNAs ==
 
* common-name:
 
* common-name:
** xmp
+
** an n-formyl-l-methionylaminoacyl-trna
* molecular-weight:
 
** 362.192
 
* inchi-key:
 
** dctlyfzhfgencw-uuokfmhzsa-l
 
* smiles:
 
** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GMP-SYN-GLUT-RXN]]
+
* [[3.5.1.27-RXN]]
* [[GMP-SYN-NH3-RXN]]
 
* [[IMP-DEHYDROG-RXN]]
 
* [[XMPXAN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[IMP-DEHYDROG-RXN]]
 
* [[RXN0-1603]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xmp}}
+
{{#set: common-name=an n-formyl-l-methionylaminoacyl-trna}}
{{#set: molecular-weight=362.192}}
 
{{#set: inchi-key=inchikey=dctlyfzhfgencw-uuokfmhzsa-l}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite Charged-fMET-tRNAs

  • common-name:
    • an n-formyl-l-methionylaminoacyl-trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality