Difference between revisions of "Ubiquinones"

Latest revision as of 19:37, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CH33ADO ==
+== Metabolite Ubiquinones ==
 * common-name:
-** 5'-deoxyadenosine
+** a ubiquinone
-* molecular-weight:
-** 251.244
-* inchi-key:
-** xgyimtfotbmpfp-kqynxxcusa-n
-* smiles:
-** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
 == Reaction(s) known to consume the compound ==
+* [[1.10.2.2-RXN]]
+* [[1.5.5.1-RXN]]
+* [[NADH-DEHYDROG-A-RXN]]
+* [[RXN-15829]]
+* [[RXN0-5244]]
+* [[RXN0-5260]]
+* [[RXN0-5330]]
+* [[RXN0-6491]]
+* [[RXN0-7008]]
+* [[RXN66-542]]
+* [[RXN66-550]]
+* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[2.8.1.6-RXN]]
+* [[1.10.2.2-RXN]]
-* [[HEMN-RXN]]
+* [[1.5.5.1-RXN]]
-* [[RXN-14950]]
+* [[NADH-DEHYDROG-A-RXN]]
-* [[RXN-14957]]
-* [[RXN-14959]]
-* [[RXN-17472]]
-* [[RXN-17473]]
-* [[RXN0-949]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=5'-deoxyadenosine}}
+{{#set: common-name=a ubiquinone}}
-{{#set: molecular-weight=251.244}}
-{{#set: inchi-key=inchikey=xgyimtfotbmpfp-kqynxxcusa-n}}