Difference between revisions of "CPD-19160"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-cis-vaccenoyl-ACPs == * common-name: ** an (11z)-3-oxooctadec-11-enoyl-[acp] == Reaction(s) known to consume the compound == * RX...") |
(Created page with "Category:metabolite == Metabolite CPD-19160 == * common-name: ** 3-oxo-(11z)-octadecenoyl-coa * molecular-weight: ** 1041.936 * inchi-key: ** ourowzutgfhrje-saiinbspsa-j *...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19160 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-oxo-(11z)-octadecenoyl-coa |
| + | * molecular-weight: | ||
| + | ** 1041.936 | ||
| + | * inchi-key: | ||
| + | ** ourowzutgfhrje-saiinbspsa-j | ||
| + | * smiles: | ||
| + | ** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17787]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17786]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-oxo-(11z)-octadecenoyl-coa}} |
| + | {{#set: molecular-weight=1041.936}} | ||
| + | {{#set: inchi-key=inchikey=ourowzutgfhrje-saiinbspsa-j}} | ||
Latest revision as of 19:37, 17 March 2021
Contents
Metabolite CPD-19160
- common-name:
- 3-oxo-(11z)-octadecenoyl-coa
- molecular-weight:
- 1041.936
- inchi-key:
- ourowzutgfhrje-saiinbspsa-j
- smiles:
- ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
