Difference between revisions of "CPD-19160"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-ACETO-LACTATE == * common-name: ** (s)-2-acetolactate * molecular-weight: ** 131.108 * inchi-key: ** nmdwgegfjubklb-yfkpbyrvsa-m * smil...")
(Created page with "Category:metabolite == Metabolite CPD-19160 == * common-name: ** 3-oxo-(11z)-octadecenoyl-coa * molecular-weight: ** 1041.936 * inchi-key: ** ourowzutgfhrje-saiinbspsa-j *...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-ACETO-LACTATE ==
+
== Metabolite CPD-19160 ==
 
* common-name:
 
* common-name:
** (s)-2-acetolactate
+
** 3-oxo-(11z)-octadecenoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 131.108
+
** 1041.936
 
* inchi-key:
 
* inchi-key:
** nmdwgegfjubklb-yfkpbyrvsa-m
+
** ourowzutgfhrje-saiinbspsa-j
 
* smiles:
 
* smiles:
** cc(=o)c(c)(o)c(=o)[o-]
+
** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETOLACTREDUCTOISOM-RXN]]
+
* [[RXN-17787]]
* [[RXN-6081]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETOLACTSYN-RXN]]
+
* [[RXN-17786]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-2-acetolactate}}
+
{{#set: common-name=3-oxo-(11z)-octadecenoyl-coa}}
{{#set: molecular-weight=131.108}}
+
{{#set: molecular-weight=1041.936}}
{{#set: inchi-key=inchikey=nmdwgegfjubklb-yfkpbyrvsa-m}}
+
{{#set: inchi-key=inchikey=ourowzutgfhrje-saiinbspsa-j}}

Latest revision as of 19:37, 17 March 2021

Metabolite CPD-19160

  • common-name:
    • 3-oxo-(11z)-octadecenoyl-coa
  • molecular-weight:
    • 1041.936
  • inchi-key:
    • ourowzutgfhrje-saiinbspsa-j
  • smiles:
    • ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality